C21H24FN3O5 — CID 24531369
[2-[cyclohexyl-[(4-fluorophenyl)methyl]amino]-2-oxoethyl] 1-methyl-4-nitropyrrole-2-carboxylate (PubChem CID 24531369) has the molecular formula C21H24FN3O5 and a molecular weight of 417.44 g/mol. Its IUPAC name is [2-[cyclohexyl-[(4-fluorophenyl)methyl]amino]-2-oxoethyl] 1-methyl-4-nitropyrrole-2-carboxylate.
| Compound Name | [2-[cyclohexyl-[(4-fluorophenyl)methyl]amino]-2-oxoethyl] 1-methyl-4-nitropyrrole-2-carboxylate |
|---|---|
| PubChem CID | 24531369 |
| Molecular Formula | C21H24FN3O5 |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | [2-[cyclohexyl-[(4-fluorophenyl)methyl]amino]-2-oxoethyl] 1-methyl-4-nitropyrrole-2-carboxylate |
| SMILES | Cn1cc([N+](=O)[O-])cc1C(=O)OCC(=O)N(Cc1ccc(F)cc1)C1CCCCC1 |
| InChI | InChI=1S/C21H24FN3O5/c1-23-13-18(25(28)29)11-19(23)21(27)30-14-20(26)24(17-5-3-2-4-6-17)12-15-7-9-16(22)10-8-15/h7-11,13,17H,2-6,12,14H2,1H3 |
| InChIKey | MUWUJIHDBRIPPK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 94.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|