C20H16FN3O5 — CID 9490950
N-cyclopropyl-N-[(2-fluorophenyl)methyl]-2-(5-nitro-1,3-dioxoisoindol-2-yl)acetamide (PubChem CID 9490950) has the molecular formula C20H16FN3O5 and a molecular weight of 397.36 g/mol. Its IUPAC name is N-cyclopropyl-N-[(2-fluorophenyl)methyl]-2-(5-nitro-1,3-dioxoisoindol-2-yl)acetamide.
| Compound Name | N-cyclopropyl-N-[(2-fluorophenyl)methyl]-2-(5-nitro-1,3-dioxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 9490950 |
| Molecular Formula | C20H16FN3O5 |
| Molecular Weight | 397.36 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | N-cyclopropyl-N-[(2-fluorophenyl)methyl]-2-(5-nitro-1,3-dioxoisoindol-2-yl)acetamide |
| SMILES | O=C1c2ccc([N+](=O)[O-])cc2C(=O)N1CC(=O)N(Cc1ccccc1F)C1CC1 |
| InChI | InChI=1S/C20H16FN3O5/c21-17-4-2-1-3-12(17)10-22(13-5-6-13)18(25)11-23-19(26)15-8-7-14(24(28)29)9-16(15)20(23)27/h1-4,7-9,13H,5-6,10-11H2 |
| InChIKey | JBJPGZNNOPRDMC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|