C19H16ClN3O6S — CID 30395020
2-(2-chloro-4-nitrophenoxy)-N-[4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 30395020) has the molecular formula C19H16ClN3O6S and a molecular weight of 449.87 g/mol. Its IUPAC name is 2-(2-chloro-4-nitrophenoxy)-N-[4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-(2-chloro-4-nitrophenoxy)-N-[4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 30395020 |
| Molecular Formula | C19H16ClN3O6S |
| Molecular Weight | 449.87 g/mol |
| Exact Mass | 449.04 |
| IUPAC Name | 2-(2-chloro-4-nitrophenoxy)-N-[4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | COc1ccc(-c2csc(NC(=O)COc3ccc([N+](=O)[O-])cc3Cl)n2)c(OC)c1 |
| InChI | InChI=1S/C19H16ClN3O6S/c1-27-12-4-5-13(17(8-12)28-2)15-10-30-19(21-15)22-18(24)9-29-16-6-3-11(23(25)26)7-14(16)20/h3-8,10H,9H2,1-2H3,(H,21,22,24) |
| InChIKey | ZNANCMDRCKKREK-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 112.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.87 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|