C13H12N4O6 — CID 7227310
ethyl N-[2-(6-nitro-4-oxoquinazolin-3-yl)acetyl]carbamate (PubChem CID 7227310) has the molecular formula C13H12N4O6 and a molecular weight of 320.26 g/mol. Its IUPAC name is ethyl N-[2-(6-nitro-4-oxoquinazolin-3-yl)acetyl]carbamate.
| Compound Name | ethyl N-[2-(6-nitro-4-oxoquinazolin-3-yl)acetyl]carbamate |
|---|---|
| PubChem CID | 7227310 |
| Molecular Formula | C13H12N4O6 |
| Molecular Weight | 320.26 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | ethyl N-[2-(6-nitro-4-oxoquinazolin-3-yl)acetyl]carbamate |
| SMILES | CCOC(=O)NC(=O)Cn1cnc2ccc([N+](=O)[O-])cc2c1=O |
| InChI | InChI=1S/C13H12N4O6/c1-2-23-13(20)15-11(18)6-16-7-14-10-4-3-8(17(21)22)5-9(10)12(16)19/h3-5,7H,2,6H2,1H3,(H,15,18,20) |
| InChIKey | YMEQAXQDFIAZFZ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 133.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.26 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|