C14H10ClNO5 — CID 7509245
5-[(2-chloro-4-nitrophenoxy)methyl]-1,3-benzodioxole (PubChem CID 7509245) has the molecular formula C14H10ClNO5 and a molecular weight of 307.69 g/mol. Its IUPAC name is 5-[(2-chloro-4-nitrophenoxy)methyl]-1,3-benzodioxole.
| Compound Name | 5-[(2-chloro-4-nitrophenoxy)methyl]-1,3-benzodioxole |
|---|---|
| PubChem CID | 7509245 |
| Molecular Formula | C14H10ClNO5 |
| Molecular Weight | 307.69 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | 5-[(2-chloro-4-nitrophenoxy)methyl]-1,3-benzodioxole |
| SMILES | O=[N+]([O-])c1ccc(OCc2ccc3c(c2)OCO3)c(Cl)c1 |
| InChI | InChI=1S/C14H10ClNO5/c15-11-6-10(16(17)18)2-4-12(11)19-7-9-1-3-13-14(5-9)21-8-20-13/h1-6H,7-8H2 |
| InChIKey | PNYAQHLGLYFVDN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.69 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|