C14H8FIN2O3S — CID 143768861
7-[(2-fluoro-4-nitrophenoxy)methyl]-2-iodothieno[3,2-b]pyridine (PubChem CID 143768861) has the molecular formula C14H8FIN2O3S and a molecular weight of 430.20 g/mol. Its IUPAC name is 7-[(2-fluoro-4-nitrophenoxy)methyl]-2-iodothieno[3,2-b]pyridine.
| Compound Name | 7-[(2-fluoro-4-nitrophenoxy)methyl]-2-iodothieno[3,2-b]pyridine |
|---|---|
| PubChem CID | 143768861 |
| Molecular Formula | C14H8FIN2O3S |
| Molecular Weight | 430.20 g/mol |
| Exact Mass | 429.93 |
| IUPAC Name | 7-[(2-fluoro-4-nitrophenoxy)methyl]-2-iodothieno[3,2-b]pyridine |
| SMILES | O=[N+]([O-])c1ccc(OCc2ccnc3cc(I)sc23)c(F)c1 |
| InChI | InChI=1S/C14H8FIN2O3S/c15-10-5-9(18(19)20)1-2-12(10)21-7-8-3-4-17-11-6-13(16)22-14(8)11/h1-6H,7H2 |
| InChIKey | VJIUJBGRDQFUQX-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.20 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|