C14H11FN2O3S2 — CID 89033138
7-(2-fluoro-4-nitrophenoxy)-2-methylsulfanyl-2,3-dihydrothieno[3,2-b]pyridine (PubChem CID 89033138) has the molecular formula C14H11FN2O3S2 and a molecular weight of 338.39 g/mol. Its IUPAC name is 7-(2-fluoro-4-nitrophenoxy)-2-methylsulfanyl-2,3-dihydrothieno[3,2-b]pyridine.
| Compound Name | 7-(2-fluoro-4-nitrophenoxy)-2-methylsulfanyl-2,3-dihydrothieno[3,2-b]pyridine |
|---|---|
| PubChem CID | 89033138 |
| Molecular Formula | C14H11FN2O3S2 |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | 7-(2-fluoro-4-nitrophenoxy)-2-methylsulfanyl-2,3-dihydrothieno[3,2-b]pyridine |
| SMILES | CSC1Cc2nccc(Oc3ccc([N+](=O)[O-])cc3F)c2S1 |
| InChI | InChI=1S/C14H11FN2O3S2/c1-21-13-7-10-14(22-13)12(4-5-16-10)20-11-3-2-8(17(18)19)6-9(11)15/h2-6,13H,7H2,1H3 |
| InChIKey | CJCWKFRYZOGTDZ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|