C21H15F3N4O3S — CID 4113484
N-[3-(3-hydroxyanilino)quinoxalin-2-yl]-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 4113484) has the molecular formula C21H15F3N4O3S and a molecular weight of 460.44 g/mol. Its IUPAC name is N-[3-(3-hydroxyanilino)quinoxalin-2-yl]-2-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[3-(3-hydroxyanilino)quinoxalin-2-yl]-2-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 4113484 |
| Molecular Formula | C21H15F3N4O3S |
| Molecular Weight | 460.44 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | N-[3-(3-hydroxyanilino)quinoxalin-2-yl]-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1nc2ccccc2nc1Nc1cccc(O)c1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C21H15F3N4O3S/c22-21(23,24)15-8-1-4-11-18(15)32(30,31)28-20-19(25-13-6-5-7-14(29)12-13)26-16-9-2-3-10-17(16)27-20/h1-12,29H,(H,25,26)(H,27,28) |
| InChIKey | VEIJPTLVYAZIRE-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.44 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |