C23H22N4O3S — CID 133434691
N-[3-[2-[4-(hydroxymethyl)phenyl]ethylamino]quinoxalin-2-yl]benzenesulfonamide (PubChem CID 133434691) has the molecular formula C23H22N4O3S and a molecular weight of 434.52 g/mol. Its IUPAC name is N-[3-[2-[4-(hydroxymethyl)phenyl]ethylamino]quinoxalin-2-yl]benzenesulfonamide.
| Compound Name | N-[3-[2-[4-(hydroxymethyl)phenyl]ethylamino]quinoxalin-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 133434691 |
| Molecular Formula | C23H22N4O3S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | N-[3-[2-[4-(hydroxymethyl)phenyl]ethylamino]quinoxalin-2-yl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1nc2ccccc2nc1NCCc1ccc(CO)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H22N4O3S/c28-16-18-12-10-17(11-13-18)14-15-24-22-23(26-21-9-5-4-8-20(21)25-22)27-31(29,30)19-6-2-1-3-7-19/h1-13,28H,14-16H2,(H,24,25)(H,26,27) |
| InChIKey | IOROGGDOTJZWOH-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |