C23H20N2O3S — CID 166443739
N-[3-(4-methoxyphenyl)-4-methylquinolin-2-yl]benzenesulfonamide (PubChem CID 166443739) has the molecular formula C23H20N2O3S and a molecular weight of 404.49 g/mol. Its IUPAC name is N-[3-(4-methoxyphenyl)-4-methylquinolin-2-yl]benzenesulfonamide.
| Compound Name | N-[3-(4-methoxyphenyl)-4-methylquinolin-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 166443739 |
| Molecular Formula | C23H20N2O3S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | N-[3-(4-methoxyphenyl)-4-methylquinolin-2-yl]benzenesulfonamide |
| SMILES | COc1ccc(-c2c(NS(=O)(=O)c3ccccc3)nc3ccccc3c2C)cc1 |
| InChI | InChI=1S/C23H20N2O3S/c1-16-20-10-6-7-11-21(20)24-23(22(16)17-12-14-18(28-2)15-13-17)25-29(26,27)19-8-4-3-5-9-19/h3-15H,1-2H3,(H,24,25) |
| InChIKey | WDDNMJMJEBIPBT-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |