C24H23N3O2S — CID 141482670
N-[4-amino-3-(4-ethylphenyl)quinolin-2-yl]-4-methylbenzenesulfonamide (PubChem CID 141482670) has the molecular formula C24H23N3O2S and a molecular weight of 417.53 g/mol. Its IUPAC name is N-[4-amino-3-(4-ethylphenyl)quinolin-2-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[4-amino-3-(4-ethylphenyl)quinolin-2-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 141482670 |
| Molecular Formula | C24H23N3O2S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | N-[4-amino-3-(4-ethylphenyl)quinolin-2-yl]-4-methylbenzenesulfonamide |
| SMILES | CCc1ccc(-c2c(NS(=O)(=O)c3ccc(C)cc3)nc3ccccc3c2N)cc1 |
| InChI | InChI=1S/C24H23N3O2S/c1-3-17-10-12-18(13-11-17)22-23(25)20-6-4-5-7-21(20)26-24(22)27-30(28,29)19-14-8-16(2)9-15-19/h4-15H,3H2,1-2H3,(H3,25,26,27) |
| InChIKey | WIPHNTCMUBZZNQ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |