C21H22N2O3S — CID 112982764
N-[4-[(4-methoxyphenyl)methylamino]phenyl]-3-methylbenzenesulfonamide (PubChem CID 112982764) has the molecular formula C21H22N2O3S and a molecular weight of 382.49 g/mol. Its IUPAC name is N-[4-[(4-methoxyphenyl)methylamino]phenyl]-3-methylbenzenesulfonamide.
| Compound Name | N-[4-[(4-methoxyphenyl)methylamino]phenyl]-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 112982764 |
| Molecular Formula | C21H22N2O3S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | N-[4-[(4-methoxyphenyl)methylamino]phenyl]-3-methylbenzenesulfonamide |
| SMILES | COc1ccc(CNc2ccc(NS(=O)(=O)c3cccc(C)c3)cc2)cc1 |
| InChI | InChI=1S/C21H22N2O3S/c1-16-4-3-5-21(14-16)27(24,25)23-19-10-8-18(9-11-19)22-15-17-6-12-20(26-2)13-7-17/h3-14,22-23H,15H2,1-2H3 |
| InChIKey | PGZZSLYFMNLMMD-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |