C26H20N6O4S — CID 3535144
N-[3-(4-anilinoanilino)quinoxalin-2-yl]-3-nitrobenzenesulfonamide (PubChem CID 3535144) has the molecular formula C26H20N6O4S and a molecular weight of 512.55 g/mol. Its IUPAC name is N-[3-(4-anilinoanilino)quinoxalin-2-yl]-3-nitrobenzenesulfonamide.
| Compound Name | N-[3-(4-anilinoanilino)quinoxalin-2-yl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 3535144 |
| Molecular Formula | C26H20N6O4S |
| Molecular Weight | 512.55 g/mol |
| Exact Mass | 512.13 |
| IUPAC Name | N-[3-(4-anilinoanilino)quinoxalin-2-yl]-3-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1cccc(S(=O)(=O)Nc2nc3ccccc3nc2Nc2ccc(Nc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C26H20N6O4S/c33-32(34)21-9-6-10-22(17-21)37(35,36)31-26-25(29-23-11-4-5-12-24(23)30-26)28-20-15-13-19(14-16-20)27-18-7-2-1-3-8-18/h1-17,27H,(H,28,29)(H,30,31) |
| InChIKey | ZQFGETWRRQSXRZ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 139.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.55 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|