C21H14N6O4S — CID 4304675
3-nitro-N-(1-phenyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)benzenesulfonamide (PubChem CID 4304675) has the molecular formula C21H14N6O4S and a molecular weight of 446.45 g/mol. Its IUPAC name is 3-nitro-N-(1-phenyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)benzenesulfonamide.
| Compound Name | 3-nitro-N-(1-phenyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 4304675 |
| Molecular Formula | C21H14N6O4S |
| Molecular Weight | 446.45 g/mol |
| Exact Mass | 446.08 |
| IUPAC Name | 3-nitro-N-(1-phenyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)benzenesulfonamide |
| SMILES | O=[N+]([O-])c1cccc(S(=O)(=O)Nc2nc3ccccc3n3c(-c4ccccc4)nnc23)c1 |
| InChI | InChI=1S/C21H14N6O4S/c28-27(29)15-9-6-10-16(13-15)32(30,31)25-19-21-24-23-20(14-7-2-1-3-8-14)26(21)18-12-5-4-11-17(18)22-19/h1-13H,(H,22,25) |
| InChIKey | RQJHGVZJBPIGFT-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 132.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.45 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|