C24H30N4O5S — CID 5134326
N-(2-benzylideneheptylideneamino)-4-morpholin-4-ylsulfonyl-2-nitroaniline (PubChem CID 5134326) has the molecular formula C24H30N4O5S and a molecular weight of 486.59 g/mol. Its IUPAC name is N-(2-benzylideneheptylideneamino)-4-morpholin-4-ylsulfonyl-2-nitroaniline.
| Compound Name | N-(2-benzylideneheptylideneamino)-4-morpholin-4-ylsulfonyl-2-nitroaniline |
|---|---|
| PubChem CID | 5134326 |
| Molecular Formula | C24H30N4O5S |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | N-(2-benzylideneheptylideneamino)-4-morpholin-4-ylsulfonyl-2-nitroaniline |
| SMILES | CCCCCC(C=NNc1ccc(S(=O)(=O)N2CCOCC2)cc1[N+](=O)[O-])=Cc1ccccc1 |
| InChI | InChI=1S/C24H30N4O5S/c1-2-3-5-10-21(17-20-8-6-4-7-9-20)19-25-26-23-12-11-22(18-24(23)28(29)30)34(31,32)27-13-15-33-16-14-27/h4,6-9,11-12,17-19,26H,2-3,5,10,13-16H2,1H3 |
| InChIKey | PGMOOTVWTNCXBW-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 114.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|