C21H15ClF4N4O6S — CID 5203946
4-[2-[[2,4-bis(difluoromethoxy)phenyl]methylidene]hydrazinyl]-N-(4-chlorophenyl)-3-nitrobenzenesulfonamide (PubChem CID 5203946) has the molecular formula C21H15ClF4N4O6S and a molecular weight of 562.89 g/mol. Its IUPAC name is 4-[2-[[2,4-bis(difluoromethoxy)phenyl]methylidene]hydrazinyl]-N-(4-chlorophenyl)-3-nitrobenzenesulfonamide.
| Compound Name | 4-[2-[[2,4-bis(difluoromethoxy)phenyl]methylidene]hydrazinyl]-N-(4-chlorophenyl)-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 5203946 |
| Molecular Formula | C21H15ClF4N4O6S |
| Molecular Weight | 562.89 g/mol |
| Exact Mass | 562.03 |
| IUPAC Name | 4-[2-[[2,4-bis(difluoromethoxy)phenyl]methylidene]hydrazinyl]-N-(4-chlorophenyl)-3-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)Nc2ccc(Cl)cc2)ccc1NN=Cc1ccc(OC(F)F)cc1OC(F)F |
| InChI | InChI=1S/C21H15ClF4N4O6S/c22-13-2-4-14(5-3-13)29-37(33,34)16-7-8-17(18(10-16)30(31)32)28-27-11-12-1-6-15(35-20(23)24)9-19(12)36-21(25)26/h1-11,20-21,28-29H |
| InChIKey | JMJSFDXRAFUXQU-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 132.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.89 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|