C22H16ClF4N3O5S — CID 2435500
N-[[2,4-bis(difluoromethoxy)phenyl]methylideneamino]-3-[(3-chlorophenyl)sulfamoyl]benzamide (PubChem CID 2435500) has the molecular formula C22H16ClF4N3O5S and a molecular weight of 545.90 g/mol. Its IUPAC name is N-[[2,4-bis(difluoromethoxy)phenyl]methylideneamino]-3-[(3-chlorophenyl)sulfamoyl]benzamide.
| Compound Name | N-[[2,4-bis(difluoromethoxy)phenyl]methylideneamino]-3-[(3-chlorophenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 2435500 |
| Molecular Formula | C22H16ClF4N3O5S |
| Molecular Weight | 545.90 g/mol |
| Exact Mass | 545.04 |
| IUPAC Name | N-[[2,4-bis(difluoromethoxy)phenyl]methylideneamino]-3-[(3-chlorophenyl)sulfamoyl]benzamide |
| SMILES | O=C(NN=Cc1ccc(OC(F)F)cc1OC(F)F)c1cccc(S(=O)(=O)Nc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C22H16ClF4N3O5S/c23-15-4-2-5-16(10-15)30-36(32,33)18-6-1-3-13(9-18)20(31)29-28-12-14-7-8-17(34-21(24)25)11-19(14)35-22(26)27/h1-12,21-22,30H,(H,29,31) |
| InChIKey | BDDWBVRUWIIAIE-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.90 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|