C17H17F2N3O4S — CID 9359895
N-[(Z)-[2-(difluoromethoxy)phenyl]methylideneamino]-3-(dimethylsulfamoyl)benzamide (PubChem CID 9359895) has the molecular formula C17H17F2N3O4S and a molecular weight of 397.40 g/mol. Its IUPAC name is N-[(Z)-[2-(difluoromethoxy)phenyl]methylideneamino]-3-(dimethylsulfamoyl)benzamide.
| Compound Name | N-[(Z)-[2-(difluoromethoxy)phenyl]methylideneamino]-3-(dimethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 9359895 |
| Molecular Formula | C17H17F2N3O4S |
| Molecular Weight | 397.40 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | N-[(Z)-[2-(difluoromethoxy)phenyl]methylideneamino]-3-(dimethylsulfamoyl)benzamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(C(=O)N/N=C\c2ccccc2OC(F)F)c1 |
| InChI | InChI=1S/C17H17F2N3O4S/c1-22(2)27(24,25)14-8-5-7-12(10-14)16(23)21-20-11-13-6-3-4-9-15(13)26-17(18)19/h3-11,17H,1-2H3,(H,21,23)/b20-11- |
| InChIKey | FJCGTHCDVAJIHO-JAIQZWGSSA-N |
| XLogP | 2.30 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.40 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|