C23H19F4N3O5S — CID 6882597
N-[(E)-[2-(difluoromethoxy)phenyl]methylideneamino]-3-(difluoromethylsulfonyl)-4-(4-methoxyanilino)benzamide (PubChem CID 6882597) has the molecular formula C23H19F4N3O5S and a molecular weight of 525.48 g/mol. Its IUPAC name is N-[(E)-[2-(difluoromethoxy)phenyl]methylideneamino]-3-(difluoromethylsulfonyl)-4-(4-methoxyanilino)benzamide.
| Compound Name | N-[(E)-[2-(difluoromethoxy)phenyl]methylideneamino]-3-(difluoromethylsulfonyl)-4-(4-methoxyanilino)benzamide |
|---|---|
| PubChem CID | 6882597 |
| Molecular Formula | C23H19F4N3O5S |
| Molecular Weight | 525.48 g/mol |
| Exact Mass | 525.10 |
| IUPAC Name | N-[(E)-[2-(difluoromethoxy)phenyl]methylideneamino]-3-(difluoromethylsulfonyl)-4-(4-methoxyanilino)benzamide |
| SMILES | COc1ccc(Nc2ccc(C(=O)N/N=C/c3ccccc3OC(F)F)cc2S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C23H19F4N3O5S/c1-34-17-9-7-16(8-10-17)29-18-11-6-14(12-20(18)36(32,33)23(26)27)21(31)30-28-13-15-4-2-3-5-19(15)35-22(24)25/h2-13,22-23,29H,1H3,(H,30,31)/b28-13+ |
| InChIKey | YPLIPOAALPXZKT-XODNFHPESA-N |
| XLogP | 4.80 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.48 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|