C21H14F5N3O3S — CID 42992107
N-[(E)-(2,6-difluorophenyl)methylideneamino]-3-[[3-(trifluoromethyl)phenyl]sulfamoyl]benzamide (PubChem CID 42992107) has the molecular formula C21H14F5N3O3S and a molecular weight of 483.42 g/mol. Its IUPAC name is N-[(E)-(2,6-difluorophenyl)methylideneamino]-3-[[3-(trifluoromethyl)phenyl]sulfamoyl]benzamide.
| Compound Name | N-[(E)-(2,6-difluorophenyl)methylideneamino]-3-[[3-(trifluoromethyl)phenyl]sulfamoyl]benzamide |
|---|---|
| PubChem CID | 42992107 |
| Molecular Formula | C21H14F5N3O3S |
| Molecular Weight | 483.42 g/mol |
| Exact Mass | 483.07 |
| IUPAC Name | N-[(E)-(2,6-difluorophenyl)methylideneamino]-3-[[3-(trifluoromethyl)phenyl]sulfamoyl]benzamide |
| SMILES | O=C(N/N=C/c1c(F)cccc1F)c1cccc(S(=O)(=O)Nc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C21H14F5N3O3S/c22-18-8-3-9-19(23)17(18)12-27-28-20(30)13-4-1-7-16(10-13)33(31,32)29-15-6-2-5-14(11-15)21(24,25)26/h1-12,29H,(H,28,30)/b27-12+ |
| InChIKey | XOKSQWUCHWRIHE-KKMKTNMSSA-N |
| XLogP | 4.55 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.42 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|