C22H18BrN5O5S — CID 135615844
2-[(2E)-2-[(5-bromo-1H-indol-3-yl)methylidene]hydrazinyl]-N-(4-methoxyphenyl)-5-nitrobenzenesulfonamide (PubChem CID 135615844) has the molecular formula C22H18BrN5O5S and a molecular weight of 544.39 g/mol. Its IUPAC name is 2-[(2E)-2-[(5-bromo-1H-indol-3-yl)methylidene]hydrazinyl]-N-(4-methoxyphenyl)-5-nitrobenzenesulfonamide.
| Compound Name | 2-[(2E)-2-[(5-bromo-1H-indol-3-yl)methylidene]hydrazinyl]-N-(4-methoxyphenyl)-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 135615844 |
| Molecular Formula | C22H18BrN5O5S |
| Molecular Weight | 544.39 g/mol |
| Exact Mass | 543.02 |
| IUPAC Name | 2-[(2E)-2-[(5-bromo-1H-indol-3-yl)methylidene]hydrazinyl]-N-(4-methoxyphenyl)-5-nitrobenzenesulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cc([N+](=O)[O-])ccc2N/N=C/c2c[nH]c3ccc(Br)cc23)cc1 |
| InChI | InChI=1S/C22H18BrN5O5S/c1-33-18-6-3-16(4-7-18)27-34(31,32)22-11-17(28(29)30)5-9-21(22)26-25-13-14-12-24-20-8-2-15(23)10-19(14)20/h2-13,24,26-27H,1H3/b25-13+ |
| InChIKey | KHCYSFURJRSHCJ-DHRITJCHSA-N |
| XLogP | 5.09 |
| TPSA | 138.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.39 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|