C26H26N4O4S — CID 136748829
4-[(4-ethoxyphenyl)sulfonylamino]-N-[(Z)-(7-ethyl-1H-indol-3-yl)methylideneamino]benzamide (PubChem CID 136748829) has the molecular formula C26H26N4O4S and a molecular weight of 490.59 g/mol. Its IUPAC name is 4-[(4-ethoxyphenyl)sulfonylamino]-N-[(Z)-(7-ethyl-1H-indol-3-yl)methylideneamino]benzamide.
| Compound Name | 4-[(4-ethoxyphenyl)sulfonylamino]-N-[(Z)-(7-ethyl-1H-indol-3-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 136748829 |
| Molecular Formula | C26H26N4O4S |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | 4-[(4-ethoxyphenyl)sulfonylamino]-N-[(Z)-(7-ethyl-1H-indol-3-yl)methylideneamino]benzamide |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2ccc(C(=O)N/N=C\c3c[nH]c4c(CC)cccc34)cc2)cc1 |
| InChI | InChI=1S/C26H26N4O4S/c1-3-18-6-5-7-24-20(16-27-25(18)24)17-28-29-26(31)19-8-10-21(11-9-19)30-35(32,33)23-14-12-22(13-15-23)34-4-2/h5-17,27,30H,3-4H2,1-2H3,(H,29,31)/b28-17- |
| InChIKey | DXMWNYRFPOFRJK-QRQIAZFYSA-N |
| XLogP | 4.69 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|