C23H21F2N3O5S — CID 6900782
N-[(E)-[4-(difluoromethoxy)phenyl]methylideneamino]-4-[(4-ethoxyphenyl)sulfonylamino]benzamide (PubChem CID 6900782) has the molecular formula C23H21F2N3O5S and a molecular weight of 489.50 g/mol. Its IUPAC name is N-[(E)-[4-(difluoromethoxy)phenyl]methylideneamino]-4-[(4-ethoxyphenyl)sulfonylamino]benzamide.
| Compound Name | N-[(E)-[4-(difluoromethoxy)phenyl]methylideneamino]-4-[(4-ethoxyphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 6900782 |
| Molecular Formula | C23H21F2N3O5S |
| Molecular Weight | 489.50 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | N-[(E)-[4-(difluoromethoxy)phenyl]methylideneamino]-4-[(4-ethoxyphenyl)sulfonylamino]benzamide |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2ccc(C(=O)N/N=C/c3ccc(OC(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C23H21F2N3O5S/c1-2-32-19-11-13-21(14-12-19)34(30,31)28-18-7-5-17(6-8-18)22(29)27-26-15-16-3-9-20(10-4-16)33-23(24)25/h3-15,23,28H,2H2,1H3,(H,27,29)/b26-15+ |
| InChIKey | YASUHCCVDIGDBX-CVKSISIWSA-N |
| XLogP | 4.25 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.50 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|