C20H18N4O7S — CID 6901877
4-[(4-ethoxyphenyl)sulfonylamino]-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]benzamide (PubChem CID 6901877) has the molecular formula C20H18N4O7S and a molecular weight of 458.45 g/mol. Its IUPAC name is 4-[(4-ethoxyphenyl)sulfonylamino]-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]benzamide.
| Compound Name | 4-[(4-ethoxyphenyl)sulfonylamino]-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 6901877 |
| Molecular Formula | C20H18N4O7S |
| Molecular Weight | 458.45 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | 4-[(4-ethoxyphenyl)sulfonylamino]-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]benzamide |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2ccc(C(=O)N/N=C/c3ccc([N+](=O)[O-])o3)cc2)cc1 |
| InChI | InChI=1S/C20H18N4O7S/c1-2-30-16-7-10-18(11-8-16)32(28,29)23-15-5-3-14(4-6-15)20(25)22-21-13-17-9-12-19(31-17)24(26)27/h3-13,23H,2H2,1H3,(H,22,25)/b21-13+ |
| InChIKey | RPHSXTGQJUHYOJ-FYJGNVAPSA-N |
| XLogP | 3.15 |
| TPSA | 153.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.45 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|