C20H15BrN2O3S — CID 3670568
[4-bromo-2-[(thiophene-2-carbonylhydrazinylidene)methyl]phenyl] 4-methylbenzoate (PubChem CID 3670568) has the molecular formula C20H15BrN2O3S and a molecular weight of 443.32 g/mol. Its IUPAC name is [4-bromo-2-[(thiophene-2-carbonylhydrazinylidene)methyl]phenyl] 4-methylbenzoate.
| Compound Name | [4-bromo-2-[(thiophene-2-carbonylhydrazinylidene)methyl]phenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 3670568 |
| Molecular Formula | C20H15BrN2O3S |
| Molecular Weight | 443.32 g/mol |
| Exact Mass | 442.00 |
| IUPAC Name | [4-bromo-2-[(thiophene-2-carbonylhydrazinylidene)methyl]phenyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2ccc(Br)cc2C=NNC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C20H15BrN2O3S/c1-13-4-6-14(7-5-13)20(25)26-17-9-8-16(21)11-15(17)12-22-23-19(24)18-3-2-10-27-18/h2-12H,1H3,(H,23,24) |
| InChIKey | WGERORVGNGPMOT-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.32 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|