C30H22ClN3O4 — CID 126003248
[2-[(Z)-[[2-[[(E)-3-phenylprop-2-enoyl]amino]benzoyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate (PubChem CID 126003248) has the molecular formula C30H22ClN3O4 and a molecular weight of 523.98 g/mol. Its IUPAC name is [2-[(Z)-[[2-[[(E)-3-phenylprop-2-enoyl]amino]benzoyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate.
| Compound Name | [2-[(Z)-[[2-[[(E)-3-phenylprop-2-enoyl]amino]benzoyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 126003248 |
| Molecular Formula | C30H22ClN3O4 |
| Molecular Weight | 523.98 g/mol |
| Exact Mass | 523.13 |
| IUPAC Name | [2-[(Z)-[[2-[[(E)-3-phenylprop-2-enoyl]amino]benzoyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
| SMILES | O=C(/C=C/c1ccccc1)Nc1ccccc1C(=O)N/N=C\c1ccccc1OC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H22ClN3O4/c31-24-17-15-22(16-18-24)30(37)38-27-13-7-4-10-23(27)20-32-34-29(36)25-11-5-6-12-26(25)33-28(35)19-14-21-8-2-1-3-9-21/h1-20H,(H,33,35)(H,34,36)/b19-14+,32-20- |
| InChIKey | JLQSONPGCJITDF-QQMURXAZSA-N |
| XLogP | 5.97 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.98 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|