C28H23BrN2O6 — CID 6103188
[4-bromo-2-[(Z)-[(2-naphthalen-1-yloxyacetyl)hydrazinylidene]methyl]phenyl] 3,4-dimethoxybenzoate (PubChem CID 6103188) has the molecular formula C28H23BrN2O6 and a molecular weight of 563.40 g/mol. Its IUPAC name is [4-bromo-2-[(Z)-[(2-naphthalen-1-yloxyacetyl)hydrazinylidene]methyl]phenyl] 3,4-dimethoxybenzoate.
| Compound Name | [4-bromo-2-[(Z)-[(2-naphthalen-1-yloxyacetyl)hydrazinylidene]methyl]phenyl] 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 6103188 |
| Molecular Formula | C28H23BrN2O6 |
| Molecular Weight | 563.40 g/mol |
| Exact Mass | 562.07 |
| IUPAC Name | [4-bromo-2-[(Z)-[(2-naphthalen-1-yloxyacetyl)hydrazinylidene]methyl]phenyl] 3,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc(Br)cc2/C=N\NC(=O)COc2cccc3ccccc23)cc1OC |
| InChI | InChI=1S/C28H23BrN2O6/c1-34-25-12-10-19(15-26(25)35-2)28(33)37-23-13-11-21(29)14-20(23)16-30-31-27(32)17-36-24-9-5-7-18-6-3-4-8-22(18)24/h3-16H,17H2,1-2H3,(H,31,32)/b30-16- |
| InChIKey | QKSRPSICMYGKOG-UHBFCERESA-N |
| XLogP | 5.37 |
| TPSA | 95.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.40 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|