C27H25BrN2O6 — CID 3597186
[4-bromo-2-[[[2-(2-prop-2-enylphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3,4-dimethoxybenzoate (PubChem CID 3597186) has the molecular formula C27H25BrN2O6 and a molecular weight of 553.41 g/mol. Its IUPAC name is [4-bromo-2-[[[2-(2-prop-2-enylphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3,4-dimethoxybenzoate.
| Compound Name | [4-bromo-2-[[[2-(2-prop-2-enylphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 3597186 |
| Molecular Formula | C27H25BrN2O6 |
| Molecular Weight | 553.41 g/mol |
| Exact Mass | 552.09 |
| IUPAC Name | [4-bromo-2-[[[2-(2-prop-2-enylphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3,4-dimethoxybenzoate |
| SMILES | C=CCc1ccccc1OCC(=O)NN=Cc1cc(Br)ccc1OC(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C27H25BrN2O6/c1-4-7-18-8-5-6-9-22(18)35-17-26(31)30-29-16-20-14-21(28)11-13-23(20)36-27(32)19-10-12-24(33-2)25(15-19)34-3/h4-6,8-16H,1,7,17H2,2-3H3,(H,30,31) |
| InChIKey | LNIJSZHXAALVHK-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 95.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.41 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|