C25H22Cl2N4O6 — CID 126266144
N-[(E)-[3-chloro-4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]-5-ethoxyphenyl]methylideneamino]-4-nitrobenzamide (PubChem CID 126266144) has the molecular formula C25H22Cl2N4O6 and a molecular weight of 545.38 g/mol. Its IUPAC name is N-[(E)-[3-chloro-4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]-5-ethoxyphenyl]methylideneamino]-4-nitrobenzamide.
| Compound Name | N-[(E)-[3-chloro-4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]-5-ethoxyphenyl]methylideneamino]-4-nitrobenzamide |
|---|---|
| PubChem CID | 126266144 |
| Molecular Formula | C25H22Cl2N4O6 |
| Molecular Weight | 545.38 g/mol |
| Exact Mass | 544.09 |
| IUPAC Name | N-[(E)-[3-chloro-4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]-5-ethoxyphenyl]methylideneamino]-4-nitrobenzamide |
| SMILES | CCOc1cc(/C=N/NC(=O)c2ccc([N+](=O)[O-])cc2)cc(Cl)c1OCC(=O)Nc1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C25H22Cl2N4O6/c1-3-36-22-11-16(13-28-30-25(33)17-5-8-19(9-6-17)31(34)35)10-21(27)24(22)37-14-23(32)29-18-7-4-15(2)20(26)12-18/h4-13H,3,14H2,1-2H3,(H,29,32)(H,30,33)/b28-13+ |
| InChIKey | INKQRCFXVPXDEX-XODNFHPESA-N |
| XLogP | 5.39 |
| TPSA | 132.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.38 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|