C33H33N3O5 — CID 126264393
N-[(E)-[2-[2-(2,5-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]-3-ethoxy-4-phenylmethoxybenzamide (PubChem CID 126264393) has the molecular formula C33H33N3O5 and a molecular weight of 551.64 g/mol. Its IUPAC name is N-[(E)-[2-[2-(2,5-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]-3-ethoxy-4-phenylmethoxybenzamide.
| Compound Name | N-[(E)-[2-[2-(2,5-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]-3-ethoxy-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 126264393 |
| Molecular Formula | C33H33N3O5 |
| Molecular Weight | 551.64 g/mol |
| Exact Mass | 551.24 |
| IUPAC Name | N-[(E)-[2-[2-(2,5-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]-3-ethoxy-4-phenylmethoxybenzamide |
| SMILES | CCOc1cc(C(=O)N/N=C/c2ccccc2OCC(=O)Nc2cc(C)ccc2C)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C33H33N3O5/c1-4-39-31-19-26(16-17-30(31)40-21-25-10-6-5-7-11-25)33(38)36-34-20-27-12-8-9-13-29(27)41-22-32(37)35-28-18-23(2)14-15-24(28)3/h5-20H,4,21-22H2,1-3H3,(H,35,37)(H,36,38)/b34-20+ |
| InChIKey | UHMXAPVEIMKPLY-QXUDOOCXSA-N |
| XLogP | 6.06 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.64 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|