C20H22N4O8 — CID 136870210
N-[2-[(2Z)-2-[(3-ethoxy-4-hydroxy-5-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]-3,4-dimethoxybenzamide (PubChem CID 136870210) has the molecular formula C20H22N4O8 and a molecular weight of 446.42 g/mol. Its IUPAC name is N-[2-[(2Z)-2-[(3-ethoxy-4-hydroxy-5-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[2-[(2Z)-2-[(3-ethoxy-4-hydroxy-5-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 136870210 |
| Molecular Formula | C20H22N4O8 |
| Molecular Weight | 446.42 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | N-[2-[(2Z)-2-[(3-ethoxy-4-hydroxy-5-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]-3,4-dimethoxybenzamide |
| SMILES | CCOc1cc(/C=N\NC(=O)CNC(=O)c2ccc(OC)c(OC)c2)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C20H22N4O8/c1-4-32-17-8-12(7-14(19(17)26)24(28)29)10-22-23-18(25)11-21-20(27)13-5-6-15(30-2)16(9-13)31-3/h5-10,26H,4,11H2,1-3H3,(H,21,27)(H,23,25)/b22-10- |
| InChIKey | OQTHKWJSIRWBQP-YVNNLAQVSA-N |
| XLogP | 1.60 |
| TPSA | 161.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.42 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|