C18H17FN4O6 — CID 135682532
N-[2-[(2Z)-2-[(3-ethoxy-4-hydroxy-5-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]-3-fluorobenzamide (PubChem CID 135682532) has the molecular formula C18H17FN4O6 and a molecular weight of 404.35 g/mol. Its IUPAC name is N-[2-[(2Z)-2-[(3-ethoxy-4-hydroxy-5-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]-3-fluorobenzamide.
| Compound Name | N-[2-[(2Z)-2-[(3-ethoxy-4-hydroxy-5-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 135682532 |
| Molecular Formula | C18H17FN4O6 |
| Molecular Weight | 404.35 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | N-[2-[(2Z)-2-[(3-ethoxy-4-hydroxy-5-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]-3-fluorobenzamide |
| SMILES | CCOc1cc(/C=N\NC(=O)CNC(=O)c2cccc(F)c2)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C18H17FN4O6/c1-2-29-15-7-11(6-14(17(15)25)23(27)28)9-21-22-16(24)10-20-18(26)12-4-3-5-13(19)8-12/h3-9,25H,2,10H2,1H3,(H,20,26)(H,22,24)/b21-9- |
| InChIKey | USLPVYUMMCBGSE-NKVSQWTQSA-N |
| XLogP | 1.72 |
| TPSA | 143.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.35 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|