C17H15BrFN3O4 — CID 136909142
N-[2-[(2Z)-2-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-3-fluorobenzamide (PubChem CID 136909142) has the molecular formula C17H15BrFN3O4 and a molecular weight of 424.23 g/mol. Its IUPAC name is N-[2-[(2Z)-2-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-3-fluorobenzamide.
| Compound Name | N-[2-[(2Z)-2-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 136909142 |
| Molecular Formula | C17H15BrFN3O4 |
| Molecular Weight | 424.23 g/mol |
| Exact Mass | 423.02 |
| IUPAC Name | N-[2-[(2Z)-2-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-3-fluorobenzamide |
| SMILES | COc1cc(/C=N\NC(=O)CNC(=O)c2cccc(F)c2)cc(Br)c1O |
| InChI | InChI=1S/C17H15BrFN3O4/c1-26-14-6-10(5-13(18)16(14)24)8-21-22-15(23)9-20-17(25)11-3-2-4-12(19)7-11/h2-8,24H,9H2,1H3,(H,20,25)(H,22,23)/b21-8- |
| InChIKey | IIJYCHYEUGGRJB-WNFQYIGGSA-N |
| XLogP | 2.18 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.23 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|