C14H13Br2N3O3 — CID 86766228
4,5-dibromo-N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]-1H-pyrrole-2-carboxamide (PubChem CID 86766228) has the molecular formula C14H13Br2N3O3 and a molecular weight of 431.08 g/mol. Its IUPAC name is 4,5-dibromo-N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]-1H-pyrrole-2-carboxamide.
| Compound Name | 4,5-dibromo-N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 86766228 |
| Molecular Formula | C14H13Br2N3O3 |
| Molecular Weight | 431.08 g/mol |
| Exact Mass | 428.93 |
| IUPAC Name | 4,5-dibromo-N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]-1H-pyrrole-2-carboxamide |
| SMILES | COc1ccc(/C=N/NC(=O)c2cc(Br)c(Br)[nH]2)cc1OC |
| InChI | InChI=1S/C14H13Br2N3O3/c1-21-11-4-3-8(5-12(11)22-2)7-17-19-14(20)10-6-9(15)13(16)18-10/h3-7,18H,1-2H3,(H,19,20)/b17-7+ |
| InChIKey | OXBHWKIWRWHWKH-REZTVBANSA-N |
| XLogP | 3.32 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.08 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|