C20H19BrN4O4 — CID 6865080
N-[(E)-(3-bromo-4-methoxyphenyl)methylideneamino]-3-(3,4-dimethoxyphenyl)-1H-pyrazole-5-carboxamide (PubChem CID 6865080) has the molecular formula C20H19BrN4O4 and a molecular weight of 459.30 g/mol. Its IUPAC name is N-[(E)-(3-bromo-4-methoxyphenyl)methylideneamino]-3-(3,4-dimethoxyphenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(E)-(3-bromo-4-methoxyphenyl)methylideneamino]-3-(3,4-dimethoxyphenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 6865080 |
| Molecular Formula | C20H19BrN4O4 |
| Molecular Weight | 459.30 g/mol |
| Exact Mass | 458.06 |
| IUPAC Name | N-[(E)-(3-bromo-4-methoxyphenyl)methylideneamino]-3-(3,4-dimethoxyphenyl)-1H-pyrazole-5-carboxamide |
| SMILES | COc1ccc(/C=N/NC(=O)c2cc(-c3ccc(OC)c(OC)c3)n[nH]2)cc1Br |
| InChI | InChI=1S/C20H19BrN4O4/c1-27-17-6-4-12(8-14(17)21)11-22-25-20(26)16-10-15(23-24-16)13-5-7-18(28-2)19(9-13)29-3/h4-11H,1-3H3,(H,23,24)(H,25,26)/b22-11+ |
| InChIKey | OPPYQNOBXBRJQQ-SSDVNMTOSA-N |
| XLogP | 3.63 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.30 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|