C19H16Cl2N4O3 — CID 4297115
N-[(2,4-dichlorophenyl)methylideneamino]-3-(3,4-dimethoxyphenyl)-1H-pyrazole-5-carboxamide (PubChem CID 4297115) has the molecular formula C19H16Cl2N4O3 and a molecular weight of 419.27 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methylideneamino]-3-(3,4-dimethoxyphenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(2,4-dichlorophenyl)methylideneamino]-3-(3,4-dimethoxyphenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 4297115 |
| Molecular Formula | C19H16Cl2N4O3 |
| Molecular Weight | 419.27 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methylideneamino]-3-(3,4-dimethoxyphenyl)-1H-pyrazole-5-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)NN=Cc3ccc(Cl)cc3Cl)[nH]n2)cc1OC |
| InChI | InChI=1S/C19H16Cl2N4O3/c1-27-17-6-4-11(7-18(17)28-2)15-9-16(24-23-15)19(26)25-22-10-12-3-5-13(20)8-14(12)21/h3-10H,1-2H3,(H,23,24)(H,25,26) |
| InChIKey | YDWDSQRFAKEIAC-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.27 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|