C20H17N3O8 — CID 126249456
(2R)-2-[2-methoxy-6-[(Z)-[(5-nitro-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]phenoxy]propanoic acid (PubChem CID 126249456) has the molecular formula C20H17N3O8 and a molecular weight of 427.37 g/mol. Its IUPAC name is (2R)-2-[2-methoxy-6-[(Z)-[(5-nitro-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]phenoxy]propanoic acid.
| Compound Name | (2R)-2-[2-methoxy-6-[(Z)-[(5-nitro-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 126249456 |
| Molecular Formula | C20H17N3O8 |
| Molecular Weight | 427.37 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | (2R)-2-[2-methoxy-6-[(Z)-[(5-nitro-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]phenoxy]propanoic acid |
| SMILES | COc1cccc(/C=N\NC(=O)c2cc3cc([N+](=O)[O-])ccc3o2)c1O[C@H](C)C(=O)O |
| InChI | InChI=1S/C20H17N3O8/c1-11(20(25)26)30-18-12(4-3-5-16(18)29-2)10-21-22-19(24)17-9-13-8-14(23(27)28)6-7-15(13)31-17/h3-11H,1-2H3,(H,22,24)(H,25,26)/b21-10-/t11-/m1/s1 |
| InChIKey | ZRKDGGNSVLQKNU-VARIZKOUSA-N |
| XLogP | 2.97 |
| TPSA | 153.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|