C27H19N3O5 — CID 3755127
N-[[2-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-5-nitro-1-benzofuran-2-carboxamide (PubChem CID 3755127) has the molecular formula C27H19N3O5 and a molecular weight of 465.47 g/mol. Its IUPAC name is N-[[2-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-5-nitro-1-benzofuran-2-carboxamide.
| Compound Name | N-[[2-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-5-nitro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 3755127 |
| Molecular Formula | C27H19N3O5 |
| Molecular Weight | 465.47 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | N-[[2-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-5-nitro-1-benzofuran-2-carboxamide |
| SMILES | O=C(NN=Cc1ccccc1OCc1cccc2ccccc12)c1cc2cc([N+](=O)[O-])ccc2o1 |
| InChI | InChI=1S/C27H19N3O5/c31-27(26-15-21-14-22(30(32)33)12-13-25(21)35-26)29-28-16-19-7-2-4-11-24(19)34-17-20-9-5-8-18-6-1-3-10-23(18)20/h1-16H,17H2,(H,29,31) |
| InChIKey | MPOATDMKGHMDJW-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.47 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|