C24H18BrN3O6 — CID 6026439
N-[(Z)-[2-bromo-5-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 6026439) has the molecular formula C24H18BrN3O6 and a molecular weight of 524.33 g/mol. Its IUPAC name is N-[(Z)-[2-bromo-5-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | N-[(Z)-[2-bromo-5-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 6026439 |
| Molecular Formula | C24H18BrN3O6 |
| Molecular Weight | 524.33 g/mol |
| Exact Mass | 523.04 |
| IUPAC Name | N-[(Z)-[2-bromo-5-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | COc1cc(/C=N\NC(=O)c2cc3ccccc3o2)c(Br)cc1OCc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H18BrN3O6/c1-32-21-11-17(13-26-27-24(29)23-10-16-6-2-3-8-20(16)34-23)19(25)12-22(21)33-14-15-5-4-7-18(9-15)28(30)31/h2-13H,14H2,1H3,(H,27,29)/b26-13- |
| InChIKey | MWPYQOQGTGYKGN-ZMFRSBBQSA-N |
| XLogP | 5.45 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.33 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|