C18H16N3O7- — CID 7323578
(2S)-2-[2-methoxy-6-[(Z)-[(3-nitrobenzoyl)hydrazinylidene]methyl]phenoxy]propanoate (PubChem CID 7323578) has the molecular formula C18H16N3O7- and a molecular weight of 386.34 g/mol. Its IUPAC name is (2S)-2-[2-methoxy-6-[(Z)-[(3-nitrobenzoyl)hydrazinylidene]methyl]phenoxy]propanoate.
| Compound Name | (2S)-2-[2-methoxy-6-[(Z)-[(3-nitrobenzoyl)hydrazinylidene]methyl]phenoxy]propanoate |
|---|---|
| PubChem CID | 7323578 |
| Molecular Formula | C18H16N3O7- |
| Molecular Weight | 386.34 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | (2S)-2-[2-methoxy-6-[(Z)-[(3-nitrobenzoyl)hydrazinylidene]methyl]phenoxy]propanoate |
| SMILES | COc1cccc(/C=N\NC(=O)c2cccc([N+](=O)[O-])c2)c1O[C@@H](C)C(=O)[O-] |
| InChI | InChI=1S/C18H17N3O7/c1-11(18(23)24)28-16-13(6-4-8-15(16)27-2)10-19-20-17(22)12-5-3-7-14(9-12)21(25)26/h3-11H,1-2H3,(H,20,22)(H,23,24)/p-1/b19-10-/t11-/m0/s1 |
| InChIKey | LVWYACZPSPXROV-ORPVNXHJSA-M |
| XLogP | 0.88 |
| TPSA | 143.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.34 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|