C18H11F3O6S2 — CID 10863168
(2,7-dimethoxy-10-oxoindeno[1,2-b][1]benzothiol-9-yl) trifluoromethanesulfonate (PubChem CID 10863168) has the molecular formula C18H11F3O6S2 and a molecular weight of 444.41 g/mol. Its IUPAC name is (2,7-dimethoxy-10-oxoindeno[1,2-b][1]benzothiol-9-yl) trifluoromethanesulfonate.
| Compound Name | (2,7-dimethoxy-10-oxoindeno[1,2-b][1]benzothiol-9-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10863168 |
| Molecular Formula | C18H11F3O6S2 |
| Molecular Weight | 444.41 g/mol |
| Exact Mass | 443.99 |
| IUPAC Name | (2,7-dimethoxy-10-oxoindeno[1,2-b][1]benzothiol-9-yl) trifluoromethanesulfonate |
| SMILES | COc1ccc2c(c1)C(=O)c1c-2sc2cc(OC)cc(OS(=O)(=O)C(F)(F)F)c12 |
| InChI | InChI=1S/C18H11F3O6S2/c1-25-8-3-4-10-11(5-8)16(22)15-14-12(27-29(23,24)18(19,20)21)6-9(26-2)7-13(14)28-17(10)15/h3-7H,1-2H3 |
| InChIKey | HLDXIDISGULGCX-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.41 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|