C11H10F3NO5S — CID 87900891
(3,5-dimethoxy-1H-isoindol-1-yl) trifluoromethanesulfonate (PubChem CID 87900891) has the molecular formula C11H10F3NO5S and a molecular weight of 325.26 g/mol. Its IUPAC name is (3,5-dimethoxy-1H-isoindol-1-yl) trifluoromethanesulfonate.
| Compound Name | (3,5-dimethoxy-1H-isoindol-1-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87900891 |
| Molecular Formula | C11H10F3NO5S |
| Molecular Weight | 325.26 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | (3,5-dimethoxy-1H-isoindol-1-yl) trifluoromethanesulfonate |
| SMILES | COC1=NC(OS(=O)(=O)C(F)(F)F)c2ccc(OC)cc21 |
| InChI | InChI=1S/C11H10F3NO5S/c1-18-6-3-4-7-8(5-6)9(19-2)15-10(7)20-21(16,17)11(12,13)14/h3-5,10H,1-2H3 |
| InChIKey | FHYKEWYWILBSGY-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.26 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|