C17H12F3NO7S — CID 118409334
(2,10-dimethoxy-5,7-dioxobenzo[d][2]benzazepin-6-yl) trifluoromethanesulfonate (PubChem CID 118409334) has the molecular formula C17H12F3NO7S and a molecular weight of 431.34 g/mol. Its IUPAC name is (2,10-dimethoxy-5,7-dioxobenzo[d][2]benzazepin-6-yl) trifluoromethanesulfonate.
| Compound Name | (2,10-dimethoxy-5,7-dioxobenzo[d][2]benzazepin-6-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 118409334 |
| Molecular Formula | C17H12F3NO7S |
| Molecular Weight | 431.34 g/mol |
| Exact Mass | 431.03 |
| IUPAC Name | (2,10-dimethoxy-5,7-dioxobenzo[d][2]benzazepin-6-yl) trifluoromethanesulfonate |
| SMILES | COc1ccc2c(=O)n(OS(=O)(=O)C(F)(F)F)c(=O)c3ccc(OC)cc3c2c1 |
| InChI | InChI=1S/C17H12F3NO7S/c1-26-9-3-5-11-13(7-9)14-8-10(27-2)4-6-12(14)16(23)21(15(11)22)28-29(24,25)17(18,19)20/h3-8H,1-2H3 |
| InChIKey | JDUJDYCZSQZEAG-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 100.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.34 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|