C18H15F3N2O6S — CID 19100014
[3-cyano-6-[(E)-2-(2,4-dimethoxyphenyl)ethenyl]-4-methyl-2-oxo-1-pyridinyl] trifluoromethanesulfonate (PubChem CID 19100014) has the molecular formula C18H15F3N2O6S and a molecular weight of 444.39 g/mol. Its IUPAC name is [3-cyano-6-[(E)-2-(2,4-dimethoxyphenyl)ethenyl]-4-methyl-2-oxo-1-pyridinyl] trifluoromethanesulfonate.
| Compound Name | [3-cyano-6-[(E)-2-(2,4-dimethoxyphenyl)ethenyl]-4-methyl-2-oxo-1-pyridinyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 19100014 |
| Molecular Formula | C18H15F3N2O6S |
| Molecular Weight | 444.39 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | [3-cyano-6-[(E)-2-(2,4-dimethoxyphenyl)ethenyl]-4-methyl-2-oxo-1-pyridinyl] trifluoromethanesulfonate |
| SMILES | COc1ccc(/C=C/c2cc(C)c(C#N)c(=O)n2OS(=O)(=O)C(F)(F)F)c(OC)c1 |
| InChI | InChI=1S/C18H15F3N2O6S/c1-11-8-13(6-4-12-5-7-14(27-2)9-16(12)28-3)23(17(24)15(11)10-22)29-30(25,26)18(19,20)21/h4-9H,1-3H3/b6-4+ |
| InChIKey | MIFYTHLXISAOQJ-GQCTYLIASA-N |
| XLogP | 2.49 |
| TPSA | 107.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|