C12H14F2N2O2 — CID 174983965
[2-(azetidin-1-ylmethyl)-3,6-difluorophenyl]methyl carbamate (PubChem CID 174983965) has the molecular formula C12H14F2N2O2 and a molecular weight of 256.25 g/mol. Its IUPAC name is [2-(azetidin-1-ylmethyl)-3,6-difluorophenyl]methyl carbamate.
| Compound Name | [2-(azetidin-1-ylmethyl)-3,6-difluorophenyl]methyl carbamate |
|---|---|
| PubChem CID | 174983965 |
| Molecular Formula | C12H14F2N2O2 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | [2-(azetidin-1-ylmethyl)-3,6-difluorophenyl]methyl carbamate |
| SMILES | NC(=O)OCc1c(F)ccc(F)c1CN1CCC1 |
| InChI | InChI=1S/C12H14F2N2O2/c13-10-2-3-11(14)9(7-18-12(15)17)8(10)6-16-4-1-5-16/h2-3H,1,4-7H2,(H2,15,17) |
| InChIKey | CXMLWLHKQKAHHE-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |