C26H31NO4 — CID 67793290
1-O-benzyl 3-O-ethyl 2-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1,3-dicarboxylate (PubChem CID 67793290) has the molecular formula C26H31NO4 and a molecular weight of 421.54 g/mol. Its IUPAC name is 1-O-benzyl 3-O-ethyl 2-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1,3-dicarboxylate.
| Compound Name | 1-O-benzyl 3-O-ethyl 2-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1,3-dicarboxylate |
|---|---|
| PubChem CID | 67793290 |
| Molecular Formula | C26H31NO4 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | 1-O-benzyl 3-O-ethyl 2-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1,3-dicarboxylate |
| SMILES | CCOC(=O)C1CC2CCCCC2N(C(=O)OCc2ccccc2)C1c1ccccc1 |
| InChI | InChI=1S/C26H31NO4/c1-2-30-25(28)22-17-21-15-9-10-16-23(21)27(24(22)20-13-7-4-8-14-20)26(29)31-18-19-11-5-3-6-12-19/h3-8,11-14,21-24H,2,9-10,15-18H2,1H3 |
| InChIKey | SWVSLNIMVWEQFV-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |