C10H17NO4 — CID 85373599
1-O-ethyl 2-O-methyl 3-propylaziridine-1,2-dicarboxylate (PubChem CID 85373599) has the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. Its IUPAC name is 1-O-ethyl 2-O-methyl 3-propylaziridine-1,2-dicarboxylate.
| Compound Name | 1-O-ethyl 2-O-methyl 3-propylaziridine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 85373599 |
| Molecular Formula | C10H17NO4 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 1-O-ethyl 2-O-methyl 3-propylaziridine-1,2-dicarboxylate |
| SMILES | CCCC1C(C(=O)OC)N1C(=O)OCC |
| InChI | InChI=1S/C10H17NO4/c1-4-6-7-8(9(12)14-3)11(7)10(13)15-5-2/h7-8H,4-6H2,1-3H3 |
| InChIKey | DDPDNXZNYHTJPT-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|