C10H19NO — CID 102405794
1-[(2S,3S)-2,3-dipropylaziridin-1-yl]ethanone (PubChem CID 102405794) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is 1-[(2S,3S)-2,3-dipropylaziridin-1-yl]ethanone.
| Compound Name | 1-[(2S,3S)-2,3-dipropylaziridin-1-yl]ethanone |
|---|---|
| PubChem CID | 102405794 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | 1-[(2S,3S)-2,3-dipropylaziridin-1-yl]ethanone |
| SMILES | CCC[C@H]1[C@H](CCC)N1C(C)=O |
| InChI | InChI=1S/C10H19NO/c1-4-6-9-10(7-5-2)11(9)8(3)12/h9-10H,4-7H2,1-3H3/t9-,10-/m0/s1 |
| InChIKey | UMTCQFAFIYRHKZ-UWVGGRQHSA-N |
| XLogP | 2.19 |
| TPSA | 20.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|