C10H18N2O4 — CID 12789509
(3R,6R)-1,4-dihydroxy-3,6-dipropylpiperazine-2,5-dione (PubChem CID 12789509) has the molecular formula C10H18N2O4 and a molecular weight of 230.26 g/mol. Its IUPAC name is (3R,6R)-1,4-dihydroxy-3,6-dipropylpiperazine-2,5-dione.
| Compound Name | (3R,6R)-1,4-dihydroxy-3,6-dipropylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 12789509 |
| Molecular Formula | C10H18N2O4 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | (3R,6R)-1,4-dihydroxy-3,6-dipropylpiperazine-2,5-dione |
| SMILES | CCC[C@@H]1C(=O)N(O)[C@H](CCC)C(=O)N1O |
| InChI | InChI=1S/C10H18N2O4/c1-3-5-7-9(13)12(16)8(6-4-2)10(14)11(7)15/h7-8,15-16H,3-6H2,1-2H3/t7-,8-/m1/s1 |
| InChIKey | XDUVTWPGVMVSMP-HTQZYQBOSA-N |
| XLogP | 0.77 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|