C7H11NO2 — CID 10486942
(5R,6S)-6-propyl-3-oxa-1-azabicyclo[3.1.0]hexan-2-one (PubChem CID 10486942) has the molecular formula C7H11NO2 and a molecular weight of 141.17 g/mol. Its IUPAC name is (5R,6S)-6-propyl-3-oxa-1-azabicyclo[3.1.0]hexan-2-one.
| Compound Name | (5R,6S)-6-propyl-3-oxa-1-azabicyclo[3.1.0]hexan-2-one |
|---|---|
| PubChem CID | 10486942 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | (5R,6S)-6-propyl-3-oxa-1-azabicyclo[3.1.0]hexan-2-one |
| SMILES | CCC[C@H]1[C@@H]2COC(=O)N12 |
| InChI | InChI=1S/C7H11NO2/c1-2-3-5-6-4-10-7(9)8(5)6/h5-6H,2-4H2,1H3/t5-,6-,8?/m0/s1 |
| InChIKey | ZITXOPIDPBEXGR-AJFZSALYSA-N |
| XLogP | 0.99 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|